C17H22O3 — CID 10588390
methyl (6Z)-2-methoxy-3,6-dimethyl-5,8,9,10-tetrahydrobenzo[8]annulene-10-carboxylate (PubChem CID 10588390) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is methyl (6Z)-2-methoxy-3,6-dimethyl-5,8,9,10-tetrahydrobenzo[8]annulene-10-carboxylate.
| Compound Name | methyl (6Z)-2-methoxy-3,6-dimethyl-5,8,9,10-tetrahydrobenzo[8]annulene-10-carboxylate |
|---|---|
| PubChem CID | 10588390 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | methyl (6Z)-2-methoxy-3,6-dimethyl-5,8,9,10-tetrahydrobenzo[8]annulene-10-carboxylate |
| SMILES | COC(=O)C1CC/C=C(/C)Cc2cc(C)c(OC)cc21 |
| InChI | InChI=1S/C17H22O3/c1-11-6-5-7-14(17(18)20-4)15-10-16(19-3)12(2)9-13(15)8-11/h6,9-10,14H,5,7-8H2,1-4H3/b11-6- |
| InChIKey | FTEWPHARSQQNHQ-WDZFZDKYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|