C16H26S2 — CID 10588997
2-[(2E)-6-methylundeca-2,4,5-trien-4-yl]-1,3-dithiane (PubChem CID 10588997) has the molecular formula C16H26S2 and a molecular weight of 282.52 g/mol. Its IUPAC name is 2-[(2E)-6-methylundeca-2,4,5-trien-4-yl]-1,3-dithiane.
| Compound Name | 2-[(2E)-6-methylundeca-2,4,5-trien-4-yl]-1,3-dithiane |
|---|---|
| PubChem CID | 10588997 |
| Molecular Formula | C16H26S2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-[(2E)-6-methylundeca-2,4,5-trien-4-yl]-1,3-dithiane |
| SMILES | C/C=C/C(=C=C(C)CCCCC)C1SCCCS1 |
| InChI | InChI=1S/C16H26S2/c1-4-6-7-10-14(3)13-15(9-5-2)16-17-11-8-12-18-16/h5,9,16H,4,6-8,10-12H2,1-3H3/b9-5+ |
| InChIKey | RVHBNPIUGOBTLA-WEVVVXLNSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|