C18H22OS — CID 10589314
[(2R,4R)-4-phenylmethoxypentan-2-yl]sulfanylbenzene (PubChem CID 10589314) has the molecular formula C18H22OS and a molecular weight of 286.44 g/mol. Its IUPAC name is [(2R,4R)-4-phenylmethoxypentan-2-yl]sulfanylbenzene.
| Compound Name | [(2R,4R)-4-phenylmethoxypentan-2-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 10589314 |
| Molecular Formula | C18H22OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(2R,4R)-4-phenylmethoxypentan-2-yl]sulfanylbenzene |
| SMILES | C[C@H](C[C@@H](C)Sc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H22OS/c1-15(19-14-17-9-5-3-6-10-17)13-16(2)20-18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | LPXCSYGVRZRRPY-HZPDHXFCSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |