C17H24O4 — CID 10589735
(3E,5R,6E,9E,13S,14R)-5-hydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-3,6,9-triene-2,8-dione (PubChem CID 10589735) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3E,5R,6E,9E,13S,14R)-5-hydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-3,6,9-triene-2,8-dione.
| Compound Name | (3E,5R,6E,9E,13S,14R)-5-hydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-3,6,9-triene-2,8-dione |
|---|---|
| PubChem CID | 10589735 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (3E,5R,6E,9E,13S,14R)-5-hydroxy-5,9,13,14-tetramethyl-1-oxacyclotetradeca-3,6,9-triene-2,8-dione |
| SMILES | C/C1=C\CC[C@H](C)[C@@H](C)OC(=O)/C=C/[C@](C)(O)/C=C/C1=O |
| InChI | InChI=1S/C17H24O4/c1-12-6-5-7-13(2)15(18)8-10-17(4,20)11-9-16(19)21-14(12)3/h7-12,14,20H,5-6H2,1-4H3/b10-8+,11-9+,13-7+/t12-,14+,17+/m0/s1 |
| InChIKey | RZPYXXIOJYPPLT-LKSZNYMUSA-N |
| XLogP | 2.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |