About ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate
ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate (PubChem CID 10589885) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
| PubChem CID | 10589885 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
| SMILES | CCOC(=O)Cc1c(-c2ccccc2)nc2ccc(C)cn12 |
| InChI | InChI=1S/C18H18N2O2/c1-3-22-17(21)11-15-18(14-7-5-4-6-8-14)19-16-10-9-13(2)12-20(15)16/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | LIWFGLVFRZNVLR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate?
The IUPAC name of ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate (CID 10589885) is ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate.
What is the SMILES notation for ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate?
The canonical SMILES for ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate is CCOC(=O)Cc1c(-c2ccccc2)nc2ccc(C)cn12.
What is the InChIKey of ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate?
The InChIKey is LIWFGLVFRZNVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-3-22-17(21)11-15-18(14-7-5-4-6-8-14)19-16-10-9-13(2)12-20(15)16/h4-10,12H,3,11H2,1-2H3.
What are the key properties of ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate?
ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate has a molecular weight of 294.35 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate is sourced from PubChem (CID 10589885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).