C18H18N2O2 — CID 10589885
ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate (PubChem CID 10589885) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate.
| Compound Name | ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
|---|---|
| PubChem CID | 10589885 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | ethyl 2-(6-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
| SMILES | CCOC(=O)Cc1c(-c2ccccc2)nc2ccc(C)cn12 |
| InChI | InChI=1S/C18H18N2O2/c1-3-22-17(21)11-15-18(14-7-5-4-6-8-14)19-16-10-9-13(2)12-20(15)16/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | LIWFGLVFRZNVLR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |