C15H9N3O3S — CID 10591107
methyl 7-isocyanato-3-phenylthieno[2,3-b]pyrazine-6-carboxylate (PubChem CID 10591107) has the molecular formula C15H9N3O3S and a molecular weight of 311.32 g/mol. Its IUPAC name is methyl 7-isocyanato-3-phenylthieno[2,3-b]pyrazine-6-carboxylate.
| Compound Name | methyl 7-isocyanato-3-phenylthieno[2,3-b]pyrazine-6-carboxylate |
|---|---|
| PubChem CID | 10591107 |
| Molecular Formula | C15H9N3O3S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | methyl 7-isocyanato-3-phenylthieno[2,3-b]pyrazine-6-carboxylate |
| SMILES | COC(=O)c1sc2nc(-c3ccccc3)cnc2c1N=C=O |
| InChI | InChI=1S/C15H9N3O3S/c1-21-15(20)13-11(17-8-19)12-14(22-13)18-10(7-16-12)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | UORIAVHBEZZUBY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|