C20H22N2O2 — CID 10591937
(4S,5S)-N,N-diethyl-3,4-diphenyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 10591937) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (4S,5S)-N,N-diethyl-3,4-diphenyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | (4S,5S)-N,N-diethyl-3,4-diphenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 10591937 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (4S,5S)-N,N-diethyl-3,4-diphenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1ON=C(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c1-3-22(4-2)20(23)19-17(15-11-7-5-8-12-15)18(21-24-19)16-13-9-6-10-14-16/h5-14,17,19H,3-4H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | PSBDHIURXKMPNY-HKUYNNGSSA-N |
| XLogP | 3.44 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |