C18H30O5 — CID 10592246
(3S,4S,5S,6R)-6-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-hydroxy-3,5-dimethyl-3-(3-methylbut-2-enyl)oxan-2-one (PubChem CID 10592246) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is (3S,4S,5S,6R)-6-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-hydroxy-3,5-dimethyl-3-(3-methylbut-2-enyl)oxan-2-one.
| Compound Name | (3S,4S,5S,6R)-6-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-hydroxy-3,5-dimethyl-3-(3-methylbut-2-enyl)oxan-2-one |
|---|---|
| PubChem CID | 10592246 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (3S,4S,5S,6R)-6-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-hydroxy-3,5-dimethyl-3-(3-methylbut-2-enyl)oxan-2-one |
| SMILES | CC(C)=CC[C@]1(C)C(=O)O[C@H](C[C@H]2COC(C)(C)O2)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C18H30O5/c1-11(2)7-8-18(6)15(19)12(3)14(22-16(18)20)9-13-10-21-17(4,5)23-13/h7,12-15,19H,8-10H2,1-6H3/t12-,13+,14-,15+,18+/m1/s1 |
| InChIKey | GPWWNGFIJNEQIX-JSEZXORMSA-N |
| XLogP | 2.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|