C26H46O7 — CID 52952026
2-[(2S,3R,4S,6S)-6-hydroxy-6-[(2S,4S,5S)-5-hydroxy-4-methyl-5-[(2R,3R)-2-methyl-3-[(2S)-4-methylpent-3-en-2-yl]oxiran-2-yl]pentan-2-yl]-4-methoxy-3,5,5-trimethyloxan-2-yl]acetic acid (PubChem CID 52952026) has the molecular formula C26H46O7 and a molecular weight of 470.65 g/mol. Its IUPAC name is 2-[(2S,3R,4S,6S)-6-hydroxy-6-[(2S,4S,5S)-5-hydroxy-4-methyl-5-[(2R,3R)-2-methyl-3-[(2S)-4-methylpent-3-en-2-yl]oxiran-2-yl]pentan-2-yl]-4-methoxy-3,5,5-trimethyloxan-2-yl]acetic acid.
| Compound Name | 2-[(2S,3R,4S,6S)-6-hydroxy-6-[(2S,4S,5S)-5-hydroxy-4-methyl-5-[(2R,3R)-2-methyl-3-[(2S)-4-methylpent-3-en-2-yl]oxiran-2-yl]pentan-2-yl]-4-methoxy-3,5,5-trimethyloxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 52952026 |
| Molecular Formula | C26H46O7 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 2-[(2S,3R,4S,6S)-6-hydroxy-6-[(2S,4S,5S)-5-hydroxy-4-methyl-5-[(2R,3R)-2-methyl-3-[(2S)-4-methylpent-3-en-2-yl]oxiran-2-yl]pentan-2-yl]-4-methoxy-3,5,5-trimethyloxan-2-yl]acetic acid |
| SMILES | CO[C@H]1[C@H](C)[C@H](CC(=O)O)O[C@@](O)([C@@H](C)C[C@H](C)[C@H](O)[C@@]2(C)O[C@@H]2[C@@H](C)C=C(C)C)C1(C)C |
| InChI | InChI=1S/C26H46O7/c1-14(2)11-16(4)22-25(9,33-22)21(29)15(3)12-17(5)26(30)24(7,8)23(31-10)18(6)19(32-26)13-20(27)28/h11,15-19,21-23,29-30H,12-13H2,1-10H3,(H,27,28)/t15-,16-,17-,18+,19-,21-,22+,23-,25+,26-/m0/s1 |
| InChIKey | ABLGLEMPOXGHOL-LSACBJEOSA-N |
| XLogP | 4.01 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|