C19H32O5 — CID 44378866
(1S,4S,5R)-4-(5-hydroxy-4,8-dimethylnon-7-enyl)-4-methyl-3,8-dioxabicyclo[3.2.1]octane-1-carboxylic acid (PubChem CID 44378866) has the molecular formula C19H32O5 and a molecular weight of 340.50 g/mol. Its IUPAC name is (1S,4S,5R)-4-(5-hydroxy-4,8-dimethylnon-7-enyl)-4-methyl-3,8-dioxabicyclo[3.2.1]octane-1-carboxylic acid.
| Compound Name | (1S,4S,5R)-4-(5-hydroxy-4,8-dimethylnon-7-enyl)-4-methyl-3,8-dioxabicyclo[3.2.1]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 44378866 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (1S,4S,5R)-4-(5-hydroxy-4,8-dimethylnon-7-enyl)-4-methyl-3,8-dioxabicyclo[3.2.1]octane-1-carboxylic acid |
| SMILES | CC(CCC[C@]1([C@H]2CC[C@](O2)(CO1)C(=O)O)C)C(CC=C(C)C)O |
| InChI | InChI=1S/C19H32O5/c1-13(2)7-8-15(20)14(3)6-5-10-18(4)16-9-11-19(24-16,12-23-18)17(21)22/h7,14-16,20H,5-6,8-12H2,1-4H3,(H,21,22)/t14?,15?,16-,18+,19+/m1/s1 |
| InChIKey | NIPJJJMHZMWBQH-XECQXLNKSA-N |
| XLogP | 3.20 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | 484 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|