C18H38O2Si2 — CID 10593443
tert-butyl-[(2Z,7E)-8-methoxy-1-trimethylsilylocta-2,7-dien-4-yl]oxy-dimethylsilane (PubChem CID 10593443) has the molecular formula C18H38O2Si2 and a molecular weight of 342.67 g/mol. Its IUPAC name is tert-butyl-[(2Z,7E)-8-methoxy-1-trimethylsilylocta-2,7-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2Z,7E)-8-methoxy-1-trimethylsilylocta-2,7-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10593443 |
| Molecular Formula | C18H38O2Si2 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | tert-butyl-[(2Z,7E)-8-methoxy-1-trimethylsilylocta-2,7-dien-4-yl]oxy-dimethylsilane |
| SMILES | CO/C=C/CCC(/C=C\C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O2Si2/c1-18(2,3)22(8,9)20-17(13-10-11-15-19-4)14-12-16-21(5,6)7/h11-12,14-15,17H,10,13,16H2,1-9H3/b14-12-,15-11+ |
| InChIKey | HTUSIPHLPFCISG-KGPANTCASA-N |
| XLogP | 6.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|