About 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one
7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one (PubChem CID 10593671) has the molecular formula C22H18O4
and a molecular weight of 346.38 g/mol. Its IUPAC name is 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one.
Molecular Properties
| Compound Name | 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one |
| PubChem CID | 10593671 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one |
| SMILES | CCCOc1c2ccoc2cc2oc(/C=C/c3ccccc3)cc(=O)c12 |
| InChI | InChI=1S/C22H18O4/c1-2-11-25-22-17-10-12-24-19(17)14-20-21(22)18(23)13-16(26-20)9-8-15-6-4-3-5-7-15/h3-10,12-14H,2,11H2,1H3/b9-8+ |
| InChIKey | RCPBGBWHKGZPFO-CMDGGOBGSA-N |
| XLogP | 5.50 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one?
The IUPAC name of 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one (CID 10593671) is 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one.
What is the SMILES notation for 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one?
The canonical SMILES for 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one is CCCOc1c2ccoc2cc2oc(/C=C/c3ccccc3)cc(=O)c12.
What is the InChIKey of 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one?
The InChIKey is RCPBGBWHKGZPFO-CMDGGOBGSA-N. The full InChI is InChI=1S/C22H18O4/c1-2-11-25-22-17-10-12-24-19(17)14-20-21(22)18(23)13-16(26-20)9-8-15-6-4-3-5-7-15/h3-10,12-14H,2,11H2,1H3/b9-8+.
What are the key properties of 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one?
7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one has a molecular weight of 346.38 g/mol, XLogP of 5.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(E)-2-phenylethenyl]-4-propoxyfuro[3,2-g]chromen-5-one is sourced from PubChem (CID 10593671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).