About 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one
4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one (PubChem CID 3828) has the molecular formula C14H12O5
and a molecular weight of 260.25 g/mol. Its IUPAC name is 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one.
Molecular Properties
| Compound Name | 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one |
| PubChem CID | 3828 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one |
| SMILES | COc1c2occc2c(OC)c2c(=O)cc(C)oc12 |
| InChI | InChI=1S/C14H12O5/c1-7-6-9(15)10-11(16-2)8-4-5-18-12(8)14(17-3)13(10)19-7/h4-6H,1-3H3 |
| InChIKey | HSMPDPBYAYSOBC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one?
The IUPAC name of 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one (CID 3828) is 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one.
What is the SMILES notation for 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one?
The canonical SMILES for 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one is COc1c2occc2c(OC)c2c(=O)cc(C)oc12.
What is the InChIKey of 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one?
The InChIKey is HSMPDPBYAYSOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O5/c1-7-6-9(15)10-11(16-2)8-4-5-18-12(8)14(17-3)13(10)19-7/h4-6H,1-3H3.
What are the key properties of 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one?
4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one has a molecular weight of 260.25 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one is sourced from PubChem (CID 3828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).