About Pimpinellin
Pimpinellin (PubChem CID 4825) has the molecular formula C13H10O5
and a molecular weight of 246.21 g/mol. Its IUPAC name is 5,6-dimethoxyfuro[2,3-h]chromen-2-one.
Molecular Properties
| Compound Name | Pimpinellin |
| PubChem CID | 4825 |
| Molecular Formula | C13H10O5 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 5,6-dimethoxyfuro[2,3-h]chromen-2-one |
| SMILES | COC1=C(C2=C(C=CO2)C3=C1C=CC(=O)O3)OC |
| InChI | InChI=1S/C13H10O5/c1-15-11-7-3-4-9(14)18-10(7)8-5-6-17-12(8)13(11)16-2/h3-6H,1-2H3 |
| InChIKey | BQPRWZCEKZLBHL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 366 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze Pimpinellin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Pimpinellin?
The IUPAC name of Pimpinellin (CID 4825) is 5,6-dimethoxyfuro[2,3-h]chromen-2-one.
What is the SMILES notation for Pimpinellin?
The canonical SMILES for Pimpinellin is COC1=C(C2=C(C=CO2)C3=C1C=CC(=O)O3)OC.
What is the InChIKey of Pimpinellin?
The InChIKey is BQPRWZCEKZLBHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O5/c1-15-11-7-3-4-9(14)18-10(7)8-5-6-17-12(8)13(11)16-2/h3-6H,1-2H3.
What are the key properties of Pimpinellin?
Pimpinellin has a molecular weight of 246.21 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Pimpinellin is sourced from PubChem (CID 4825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).