C14H29IOSi — CID 10595175
tert-butyl-[(E,3R)-1-iodooct-1-en-3-yl]oxy-dimethylsilane (PubChem CID 10595175) has the molecular formula C14H29IOSi and a molecular weight of 368.38 g/mol. Its IUPAC name is tert-butyl-[(E,3R)-1-iodooct-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,3R)-1-iodooct-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10595175 |
| Molecular Formula | C14H29IOSi |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | tert-butyl-[(E,3R)-1-iodooct-1-en-3-yl]oxy-dimethylsilane |
| SMILES | CCCCC[C@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29IOSi/c1-7-8-9-10-13(11-12-15)16-17(5,6)14(2,3)4/h11-13H,7-10H2,1-6H3/b12-11+/t13-/m1/s1 |
| InChIKey | LTLQAJZGKYDIDX-XZHRJIJLSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|