C14H26F3IOSi — CID 22768576
tert-butyl-dimethyl-[(E)-8,8,8-trifluoro-1-iodooct-1-en-3-yl]oxysilane (PubChem CID 22768576) has the molecular formula C14H26F3IOSi and a molecular weight of 422.35 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-8,8,8-trifluoro-1-iodooct-1-en-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E)-8,8,8-trifluoro-1-iodooct-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 22768576 |
| Molecular Formula | C14H26F3IOSi |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-8,8,8-trifluoro-1-iodooct-1-en-3-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(/C=C/I)CCCCC(F)(F)F |
| InChI | InChI=1S/C14H26F3IOSi/c1-13(2,3)20(4,5)19-12(9-11-18)8-6-7-10-14(15,16)17/h9,11-12H,6-8,10H2,1-5H3/b11-9+ |
| InChIKey | JTCDTEVKRNIKRS-PKNBQFBNSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|