C16H32F2OSi — CID 140988825
tert-butyl-(4,4-difluorodec-1-en-3-yloxy)-dimethylsilane (PubChem CID 140988825) has the molecular formula C16H32F2OSi and a molecular weight of 306.51 g/mol. Its IUPAC name is tert-butyl-(4,4-difluorodec-1-en-3-yloxy)-dimethylsilane.
| Compound Name | tert-butyl-(4,4-difluorodec-1-en-3-yloxy)-dimethylsilane |
|---|---|
| PubChem CID | 140988825 |
| Molecular Formula | C16H32F2OSi |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | tert-butyl-(4,4-difluorodec-1-en-3-yloxy)-dimethylsilane |
| SMILES | C=CC(O[Si](C)(C)C(C)(C)C)C(F)(F)CCCCCC |
| InChI | InChI=1S/C16H32F2OSi/c1-8-10-11-12-13-16(17,18)14(9-2)19-20(6,7)15(3,4)5/h9,14H,2,8,10-13H2,1,3-7H3 |
| InChIKey | FZPDOQNTQXIOBU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|