C18H19NO2S3 — CID 10595768
[(Z)-2-(4-methylphenyl)sulfonyl-2-phenylethenyl] N,N-dimethylcarbamodithioate (PubChem CID 10595768) has the molecular formula C18H19NO2S3 and a molecular weight of 377.56 g/mol. Its IUPAC name is [(Z)-2-(4-methylphenyl)sulfonyl-2-phenylethenyl] N,N-dimethylcarbamodithioate.
| Compound Name | [(Z)-2-(4-methylphenyl)sulfonyl-2-phenylethenyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 10595768 |
| Molecular Formula | C18H19NO2S3 |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | [(Z)-2-(4-methylphenyl)sulfonyl-2-phenylethenyl] N,N-dimethylcarbamodithioate |
| SMILES | Cc1ccc(S(=O)(=O)/C(=C\SC(=S)N(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO2S3/c1-14-9-11-16(12-10-14)24(20,21)17(13-23-18(22)19(2)3)15-7-5-4-6-8-15/h4-13H,1-3H3/b17-13- |
| InChIKey | FOJPHFPXJMPSPN-LGMDPLHJSA-N |
| XLogP | 4.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|