C15H16F3NO5S — CID 10595868
ethyl 1-(trifluoromethylsulfonylcarbamoyl)-3,4-dihydro-2H-naphthalene-1-carboxylate (PubChem CID 10595868) has the molecular formula C15H16F3NO5S and a molecular weight of 379.36 g/mol. Its IUPAC name is ethyl 1-(trifluoromethylsulfonylcarbamoyl)-3,4-dihydro-2H-naphthalene-1-carboxylate.
| Compound Name | ethyl 1-(trifluoromethylsulfonylcarbamoyl)-3,4-dihydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10595868 |
| Molecular Formula | C15H16F3NO5S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | ethyl 1-(trifluoromethylsulfonylcarbamoyl)-3,4-dihydro-2H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)NS(=O)(=O)C(F)(F)F)CCCc2ccccc21 |
| InChI | InChI=1S/C15H16F3NO5S/c1-2-24-13(21)14(12(20)19-25(22,23)15(16,17)18)9-5-7-10-6-3-4-8-11(10)14/h3-4,6,8H,2,5,7,9H2,1H3,(H,19,20) |
| InChIKey | LVSXDVZCINPWDB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|