C25H33N3O2 — CID 10597541
4-methoxy-N-[3-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazin-1-yl]propyl]benzamide (PubChem CID 10597541) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-methoxy-N-[3-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazin-1-yl]propyl]benzamide.
| Compound Name | 4-methoxy-N-[3-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 10597541 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 4-methoxy-N-[3-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazin-1-yl]propyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCCN2CCN(C3CCCc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O2/c1-30-22-12-10-21(11-13-22)25(29)26-14-5-15-27-16-18-28(19-17-27)24-9-4-7-20-6-2-3-8-23(20)24/h2-3,6,8,10-13,24H,4-5,7,9,14-19H2,1H3,(H,26,29) |
| InChIKey | UDJUKNPZWYMHGD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|