C14H12IN3O2S — CID 10597822
7-(benzenesulfonyl)-5-iodo-2,4-dimethylpyrrolo[2,3-d]pyrimidine (PubChem CID 10597822) has the molecular formula C14H12IN3O2S and a molecular weight of 413.24 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-5-iodo-2,4-dimethylpyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-(benzenesulfonyl)-5-iodo-2,4-dimethylpyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 10597822 |
| Molecular Formula | C14H12IN3O2S |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 7-(benzenesulfonyl)-5-iodo-2,4-dimethylpyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1nc(C)c2c(I)cn(S(=O)(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C14H12IN3O2S/c1-9-13-12(15)8-18(14(13)17-10(2)16-9)21(19,20)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | QHUBIHNPXCGTOW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|