C23H29N7O — CID 10598178
14-[2-(dimethylamino)ethyl]-10-(2-piperazin-1-ylethylamino)-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one (PubChem CID 10598178) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 14-[2-(dimethylamino)ethyl]-10-(2-piperazin-1-ylethylamino)-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one.
| Compound Name | 14-[2-(dimethylamino)ethyl]-10-(2-piperazin-1-ylethylamino)-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one |
|---|---|
| PubChem CID | 10598178 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 14-[2-(dimethylamino)ethyl]-10-(2-piperazin-1-ylethylamino)-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-8-one |
| SMILES | CN(C)CCn1nc2c3c(c(NCCN4CCNCC4)ccc31)C(=O)c1ccncc1-2 |
| InChI | InChI=1S/C23H29N7O/c1-28(2)13-14-30-19-4-3-18(26-9-12-29-10-7-24-8-11-29)20-21(19)22(27-30)17-15-25-6-5-16(17)23(20)31/h3-6,15,24,26H,7-14H2,1-2H3 |
| InChIKey | BTPPIJSTLOPSPI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|