C21H24F3NO3S — CID 10598583
N-[(1S,2R)-6,7-dimethoxy-1-(5-propylthiophen-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 10598583) has the molecular formula C21H24F3NO3S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[(1S,2R)-6,7-dimethoxy-1-(5-propylthiophen-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S,2R)-6,7-dimethoxy-1-(5-propylthiophen-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10598583 |
| Molecular Formula | C21H24F3NO3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N-[(1S,2R)-6,7-dimethoxy-1-(5-propylthiophen-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCCc1cc([C@@H]2c3cc(OC)c(OC)cc3CC[C@H]2NC(=O)C(F)(F)F)cs1 |
| InChI | InChI=1S/C21H24F3NO3S/c1-4-5-14-8-13(11-29-14)19-15-10-18(28-3)17(27-2)9-12(15)6-7-16(19)25-20(26)21(22,23)24/h8-11,16,19H,4-7H2,1-3H3,(H,25,26)/t16-,19-/m1/s1 |
| InChIKey | ISLONGPFUAXDOS-VQIMIIECSA-N |
| XLogP | 4.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |