C30H46O2 — CID 10599167
(9R,10R,13S,14S,17R)-17-[(E,2R)-4-[(2S)-3,3-dimethyloxiran-2-yl]but-3-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 10599167) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is (9R,10R,13S,14S,17R)-17-[(E,2R)-4-[(2S)-3,3-dimethyloxiran-2-yl]but-3-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9R,10R,13S,14S,17R)-17-[(E,2R)-4-[(2S)-3,3-dimethyloxiran-2-yl]but-3-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10599167 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | (9R,10R,13S,14S,17R)-17-[(E,2R)-4-[(2S)-3,3-dimethyloxiran-2-yl]but-3-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H](/C=C/[C@@H]1OC1(C)C)[C@H]1CC[C@]2(C)C3=CCC4C(C)(C)C(=O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C30H46O2/c1-19(9-12-25-27(4,5)32-25)20-13-17-30(8)22-10-11-23-26(2,3)24(31)15-16-28(23,6)21(22)14-18-29(20,30)7/h9-10,12,19-21,23,25H,11,13-18H2,1-8H3/b12-9+/t19-,20-,21+,23?,25+,28-,29+,30-/m1/s1 |
| InChIKey | NHJZKKCNKMFNLM-FNRHHYEASA-N |
| XLogP | 7.53 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|