C12H24N2O3S2 — CID 106001719
3-(hydroxymethyl)-N-(3-methylsulfanylcyclopentyl)piperidine-1-sulfonamide (PubChem CID 106001719) has the molecular formula C12H24N2O3S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 3-(hydroxymethyl)-N-(3-methylsulfanylcyclopentyl)piperidine-1-sulfonamide.
| Compound Name | 3-(hydroxymethyl)-N-(3-methylsulfanylcyclopentyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106001719 |
| Molecular Formula | C12H24N2O3S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-(hydroxymethyl)-N-(3-methylsulfanylcyclopentyl)piperidine-1-sulfonamide |
| SMILES | CSC1CCC(NS(=O)(=O)N2CCCC(CO)C2)C1 |
| InChI | InChI=1S/C12H24N2O3S2/c1-18-12-5-4-11(7-12)13-19(16,17)14-6-2-3-10(8-14)9-15/h10-13,15H,2-9H2,1H3 |
| InChIKey | RUHUBMJNJGPTSC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |