C26H37ClO5 — CID 10600237
methyl (E,7Z)-7-[4-chloro-2-[(Z)-oct-2-enyl]-2-(oxan-2-yloxy)-5-oxocyclopent-3-en-1-ylidene]hept-5-enoate (PubChem CID 10600237) has the molecular formula C26H37ClO5 and a molecular weight of 465.03 g/mol. Its IUPAC name is methyl (E,7Z)-7-[4-chloro-2-[(Z)-oct-2-enyl]-2-(oxan-2-yloxy)-5-oxocyclopent-3-en-1-ylidene]hept-5-enoate.
| Compound Name | methyl (E,7Z)-7-[4-chloro-2-[(Z)-oct-2-enyl]-2-(oxan-2-yloxy)-5-oxocyclopent-3-en-1-ylidene]hept-5-enoate |
|---|---|
| PubChem CID | 10600237 |
| Molecular Formula | C26H37ClO5 |
| Molecular Weight | 465.03 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | methyl (E,7Z)-7-[4-chloro-2-[(Z)-oct-2-enyl]-2-(oxan-2-yloxy)-5-oxocyclopent-3-en-1-ylidene]hept-5-enoate |
| SMILES | CCCCC/C=C\CC1(OC2CCCCO2)C=C(Cl)C(=O)/C1=C\C=C\CCCC(=O)OC |
| InChI | InChI=1S/C26H37ClO5/c1-3-4-5-6-9-13-18-26(32-24-17-12-14-19-31-24)20-22(27)25(29)21(26)15-10-7-8-11-16-23(28)30-2/h7,9-10,13,15,20,24H,3-6,8,11-12,14,16-19H2,1-2H3/b10-7+,13-9-,21-15+ |
| InChIKey | AIYTZQXQVDSHNW-BLJBNDNRSA-N |
| XLogP | 6.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.03 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|