C15H26N2O4 — CID 106005375
4-[3-cyclopentylpropylcarbamoyl(methyl)amino]oxolane-3-carboxylic acid (PubChem CID 106005375) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 4-[3-cyclopentylpropylcarbamoyl(methyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[3-cyclopentylpropylcarbamoyl(methyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 106005375 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-[3-cyclopentylpropylcarbamoyl(methyl)amino]oxolane-3-carboxylic acid |
| SMILES | CN(C(=O)NCCCC1CCCC1)C1COCC1C(=O)O |
| InChI | InChI=1S/C15H26N2O4/c1-17(13-10-21-9-12(13)14(18)19)15(20)16-8-4-7-11-5-2-3-6-11/h11-13H,2-10H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | SCKUPEXMRMSGRA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|