C10H18N4O5 — CID 83113561
4-[2-(carbamoylamino)ethylcarbamoyl-methylamino]oxolane-3-carboxylic acid (PubChem CID 83113561) has the molecular formula C10H18N4O5 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-[2-(carbamoylamino)ethylcarbamoyl-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[2-(carbamoylamino)ethylcarbamoyl-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 83113561 |
| Molecular Formula | C10H18N4O5 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-[2-(carbamoylamino)ethylcarbamoyl-methylamino]oxolane-3-carboxylic acid |
| SMILES | CN(C(=O)NCCNC(N)=O)C1COCC1C(=O)O |
| InChI | InChI=1S/C10H18N4O5/c1-14(7-5-19-4-6(7)8(15)16)10(18)13-3-2-12-9(11)17/h6-7H,2-5H2,1H3,(H,13,18)(H,15,16)(H3,11,12,17) |
| InChIKey | HZNJDCRDNUPQTN-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|