C16H26N2O3 — CID 106006138
2-amino-6-ethoxy-N-(4-propan-2-yloxybutyl)benzamide (PubChem CID 106006138) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-amino-6-ethoxy-N-(4-propan-2-yloxybutyl)benzamide.
| Compound Name | 2-amino-6-ethoxy-N-(4-propan-2-yloxybutyl)benzamide |
|---|---|
| PubChem CID | 106006138 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-amino-6-ethoxy-N-(4-propan-2-yloxybutyl)benzamide |
| SMILES | CCOc1cccc(N)c1C(=O)NCCCCOC(C)C |
| InChI | InChI=1S/C16H26N2O3/c1-4-20-14-9-7-8-13(17)15(14)16(19)18-10-5-6-11-21-12(2)3/h7-9,12H,4-6,10-11,17H2,1-3H3,(H,18,19) |
| InChIKey | DCUVEGPGQCIQHS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|