C14H21N3O3 — CID 106233209
2-amino-N-(5-amino-5-oxopentyl)-6-ethoxybenzamide (PubChem CID 106233209) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-amino-N-(5-amino-5-oxopentyl)-6-ethoxybenzamide.
| Compound Name | 2-amino-N-(5-amino-5-oxopentyl)-6-ethoxybenzamide |
|---|---|
| PubChem CID | 106233209 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-amino-N-(5-amino-5-oxopentyl)-6-ethoxybenzamide |
| SMILES | CCOc1cccc(N)c1C(=O)NCCCCC(N)=O |
| InChI | InChI=1S/C14H21N3O3/c1-2-20-11-7-5-6-10(15)13(11)14(19)17-9-4-3-8-12(16)18/h5-7H,2-4,8-9,15H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | FRMZXBYRKWOGPS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|