C16H21N3OS — CID 106007399
3-amino-N-ethyl-4-[(5-ethylthiophen-2-yl)methylamino]benzamide (PubChem CID 106007399) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 3-amino-N-ethyl-4-[(5-ethylthiophen-2-yl)methylamino]benzamide.
| Compound Name | 3-amino-N-ethyl-4-[(5-ethylthiophen-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 106007399 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-amino-N-ethyl-4-[(5-ethylthiophen-2-yl)methylamino]benzamide |
| SMILES | CCNC(=O)c1ccc(NCc2ccc(CC)s2)c(N)c1 |
| InChI | InChI=1S/C16H21N3OS/c1-3-12-6-7-13(21-12)10-19-15-8-5-11(9-14(15)17)16(20)18-4-2/h5-9,19H,3-4,10,17H2,1-2H3,(H,18,20) |
| InChIKey | OUZIVGZJPBRQOF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|