C14H23N3O — CID 106008187
2-amino-4,5-dimethyl-1-(4-propan-2-yloxybutyl)pyrrole-3-carbonitrile (PubChem CID 106008187) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-amino-4,5-dimethyl-1-(4-propan-2-yloxybutyl)pyrrole-3-carbonitrile.
| Compound Name | 2-amino-4,5-dimethyl-1-(4-propan-2-yloxybutyl)pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 106008187 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-amino-4,5-dimethyl-1-(4-propan-2-yloxybutyl)pyrrole-3-carbonitrile |
| SMILES | Cc1c(C#N)c(N)n(CCCCOC(C)C)c1C |
| InChI | InChI=1S/C14H23N3O/c1-10(2)18-8-6-5-7-17-12(4)11(3)13(9-15)14(17)16/h10H,5-8,16H2,1-4H3 |
| InChIKey | YYYIGAOQYBIRDJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|