C16H32N2O — CID 106008757
8-methyl-9-(4-propan-2-yloxybutyl)-6,9-diazaspiro[4.5]decane (PubChem CID 106008757) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 8-methyl-9-(4-propan-2-yloxybutyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-methyl-9-(4-propan-2-yloxybutyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 106008757 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 8-methyl-9-(4-propan-2-yloxybutyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CC(C)OCCCCN1CC2(CCCC2)NCC1C |
| InChI | InChI=1S/C16H32N2O/c1-14(2)19-11-7-6-10-18-13-16(8-4-5-9-16)17-12-15(18)3/h14-15,17H,4-13H2,1-3H3 |
| InChIKey | UVOJWJMHCFXEFU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|