C14H24N2O2S2 — CID 106012613
2-(aminomethyl)-N-[(4-ethylcyclohexyl)methyl]thiophene-3-sulfonamide (PubChem CID 106012613) has the molecular formula C14H24N2O2S2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[(4-ethylcyclohexyl)methyl]thiophene-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-[(4-ethylcyclohexyl)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106012613 |
| Molecular Formula | C14H24N2O2S2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 2-(aminomethyl)-N-[(4-ethylcyclohexyl)methyl]thiophene-3-sulfonamide |
| SMILES | CCC1CCC(CNS(=O)(=O)c2ccsc2CN)CC1 |
| InChI | InChI=1S/C14H24N2O2S2/c1-2-11-3-5-12(6-4-11)10-16-20(17,18)14-7-8-19-13(14)9-15/h7-8,11-12,16H,2-6,9-10,15H2,1H3 |
| InChIKey | BCBUJGYVBSGJOG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |