C12H22N2O2S2 — CID 114141469
2-(aminomethyl)-N-(4-methylhexan-2-yl)thiophene-3-sulfonamide (PubChem CID 114141469) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(4-methylhexan-2-yl)thiophene-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-(4-methylhexan-2-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114141469 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(aminomethyl)-N-(4-methylhexan-2-yl)thiophene-3-sulfonamide |
| SMILES | CCC(C)CC(C)NS(=O)(=O)c1ccsc1CN |
| InChI | InChI=1S/C12H22N2O2S2/c1-4-9(2)7-10(3)14-18(15,16)12-5-6-17-11(12)8-13/h5-6,9-10,14H,4,7-8,13H2,1-3H3 |
| InChIKey | FRLSULLLJWCTSL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |