C12H22N2O2S2 — CID 79469775
2-(aminomethyl)-N-ethyl-N-(2-methylbutyl)thiophene-3-sulfonamide (PubChem CID 79469775) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-(aminomethyl)-N-ethyl-N-(2-methylbutyl)thiophene-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-ethyl-N-(2-methylbutyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 79469775 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(aminomethyl)-N-ethyl-N-(2-methylbutyl)thiophene-3-sulfonamide |
| SMILES | CCC(C)CN(CC)S(=O)(=O)c1ccsc1CN |
| InChI | InChI=1S/C12H22N2O2S2/c1-4-10(3)9-14(5-2)18(15,16)12-6-7-17-11(12)8-13/h6-7,10H,4-5,8-9,13H2,1-3H3 |
| InChIKey | CJASBDLDHYTWLS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |