C11H16F3N3S — CID 106012675
N-(3-cyclopentylpropyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 106012675) has the molecular formula C11H16F3N3S and a molecular weight of 279.33 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(3-cyclopentylpropyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 106012675 |
| Molecular Formula | C11H16F3N3S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(3-cyclopentylpropyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | FC(F)(F)c1nsc(NCCCC2CCCC2)n1 |
| InChI | InChI=1S/C11H16F3N3S/c12-11(13,14)9-16-10(18-17-9)15-7-3-6-8-4-1-2-5-8/h8H,1-7H2,(H,15,16,17) |
| InChIKey | VFEKBRZRJPRPJH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|