C16H25NO3S — CID 106014654
N-(3-cyclopentylpropyl)-1-[3-(hydroxymethyl)phenyl]methanesulfonamide (PubChem CID 106014654) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-1-[3-(hydroxymethyl)phenyl]methanesulfonamide.
| Compound Name | N-(3-cyclopentylpropyl)-1-[3-(hydroxymethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 106014654 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-(3-cyclopentylpropyl)-1-[3-(hydroxymethyl)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(CO)c1)NCCCC1CCCC1 |
| InChI | InChI=1S/C16H25NO3S/c18-12-15-7-3-8-16(11-15)13-21(19,20)17-10-4-9-14-5-1-2-6-14/h3,7-8,11,14,17-18H,1-2,4-6,9-10,12-13H2 |
| InChIKey | ZKWQSPMRCSTBBL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|