C14H24N4O2S — CID 106015527
4-amino-2-(cyclopropylamino)-N-(4-propan-2-yloxybutyl)-1,3-thiazole-5-carboxamide (PubChem CID 106015527) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-amino-2-(cyclopropylamino)-N-(4-propan-2-yloxybutyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(cyclopropylamino)-N-(4-propan-2-yloxybutyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 106015527 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-amino-2-(cyclopropylamino)-N-(4-propan-2-yloxybutyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)OCCCCNC(=O)c1sc(NC2CC2)nc1N |
| InChI | InChI=1S/C14H24N4O2S/c1-9(2)20-8-4-3-7-16-13(19)11-12(15)18-14(21-11)17-10-5-6-10/h9-10H,3-8,15H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | VSQKYNJNVRCGAF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|