C15H24N2O3S — CID 106016485
5-(aminomethyl)-2,4-dimethyl-N-(oxan-3-ylmethyl)benzenesulfonamide (PubChem CID 106016485) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 5-(aminomethyl)-2,4-dimethyl-N-(oxan-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2,4-dimethyl-N-(oxan-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106016485 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 5-(aminomethyl)-2,4-dimethyl-N-(oxan-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCC2CCCOC2)cc1CN |
| InChI | InChI=1S/C15H24N2O3S/c1-11-6-12(2)15(7-14(11)8-16)21(18,19)17-9-13-4-3-5-20-10-13/h6-7,13,17H,3-5,8-10,16H2,1-2H3 |
| InChIKey | IOMOTONNOPNHES-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |