C14H22N2O4S — CID 79962057
5-amino-2-methoxy-4-methyl-N-(oxan-3-ylmethyl)benzenesulfonamide (PubChem CID 79962057) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-amino-2-methoxy-4-methyl-N-(oxan-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-methoxy-4-methyl-N-(oxan-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79962057 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 5-amino-2-methoxy-4-methyl-N-(oxan-3-ylmethyl)benzenesulfonamide |
| SMILES | COc1cc(C)c(N)cc1S(=O)(=O)NCC1CCCOC1 |
| InChI | InChI=1S/C14H22N2O4S/c1-10-6-13(19-2)14(7-12(10)15)21(17,18)16-8-11-4-3-5-20-9-11/h6-7,11,16H,3-5,8-9,15H2,1-2H3 |
| InChIKey | OUHHOHUQVHSIRR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|