C13H21BrN4O2S — CID 106020517
N-(5-bromo-2-pyridinyl)-2-(ethylaminomethyl)piperidine-1-sulfonamide (PubChem CID 106020517) has the molecular formula C13H21BrN4O2S and a molecular weight of 377.31 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-(ethylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-(ethylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106020517 |
| Molecular Formula | C13H21BrN4O2S |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-(ethylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CCNCC1CCCCN1S(=O)(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C13H21BrN4O2S/c1-2-15-10-12-5-3-4-8-18(12)21(19,20)17-13-7-6-11(14)9-16-13/h6-7,9,12,15H,2-5,8,10H2,1H3,(H,16,17) |
| InChIKey | SBNDNPCZLOKUTM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |