C13H19BrClN3O2S — CID 106056721
N-(5-bromo-2-chlorophenyl)-2-(methylaminomethyl)piperidine-1-sulfonamide (PubChem CID 106056721) has the molecular formula C13H19BrClN3O2S and a molecular weight of 396.74 g/mol. Its IUPAC name is N-(5-bromo-2-chlorophenyl)-2-(methylaminomethyl)piperidine-1-sulfonamide.
| Compound Name | N-(5-bromo-2-chlorophenyl)-2-(methylaminomethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106056721 |
| Molecular Formula | C13H19BrClN3O2S |
| Molecular Weight | 396.74 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | N-(5-bromo-2-chlorophenyl)-2-(methylaminomethyl)piperidine-1-sulfonamide |
| SMILES | CNCC1CCCCN1S(=O)(=O)Nc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C13H19BrClN3O2S/c1-16-9-11-4-2-3-7-18(11)21(19,20)17-13-8-10(14)5-6-12(13)15/h5-6,8,11,16-17H,2-4,7,9H2,1H3 |
| InChIKey | XYCSTKXWCQUVGT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |