C12H16BrFN2O2S — CID 43096857
N-(4-bromo-2-fluorophenyl)-2-methylpiperidine-1-sulfonamide (PubChem CID 43096857) has the molecular formula C12H16BrFN2O2S and a molecular weight of 351.24 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-methylpiperidine-1-sulfonamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 43096857 |
| Molecular Formula | C12H16BrFN2O2S |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCCCN1S(=O)(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H16BrFN2O2S/c1-9-4-2-3-7-16(9)19(17,18)15-12-6-5-10(13)8-11(12)14/h5-6,8-9,15H,2-4,7H2,1H3 |
| InChIKey | ZZWZOBMHWHZWQB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |