C12H17N5O2S — CID 106022701
4-(methylaminomethyl)-N-(1-pyridin-2-ylethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106022701) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is 4-(methylaminomethyl)-N-(1-pyridin-2-ylethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(methylaminomethyl)-N-(1-pyridin-2-ylethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106022701 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-(methylaminomethyl)-N-(1-pyridin-2-ylethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CNCc1cn[nH]c1S(=O)(=O)NC(C)c1ccccn1 |
| InChI | InChI=1S/C12H17N5O2S/c1-9(11-5-3-4-6-14-11)17-20(18,19)12-10(7-13-2)8-15-16-12/h3-6,8-9,13,17H,7H2,1-2H3,(H,15,16) |
| InChIKey | GKLJGMGLHBWELS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |