C16H26N4S — CID 106028883
2-N,6-dimethyl-4-N-octan-4-ylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 106028883) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is 2-N,6-dimethyl-4-N-octan-4-ylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N,6-dimethyl-4-N-octan-4-ylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 106028883 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-N,6-dimethyl-4-N-octan-4-ylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCCCC(CCC)Nc1nc(NC)nc2sc(C)cc12 |
| InChI | InChI=1S/C16H26N4S/c1-5-7-9-12(8-6-2)18-14-13-10-11(3)21-15(13)20-16(17-4)19-14/h10,12H,5-9H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | TXRCUERRYQWJME-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |