C23H43BrO10 — CID 10602935
18-(bromomethyl)-18-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]-1,4,7,10,13,16-hexaoxacyclononadecane (PubChem CID 10602935) has the molecular formula C23H43BrO10 and a molecular weight of 559.49 g/mol. Its IUPAC name is 18-(bromomethyl)-18-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]-1,4,7,10,13,16-hexaoxacyclononadecane.
| Compound Name | 18-(bromomethyl)-18-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]-1,4,7,10,13,16-hexaoxacyclononadecane |
|---|---|
| PubChem CID | 10602935 |
| Molecular Formula | C23H43BrO10 |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 18-(bromomethyl)-18-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]-1,4,7,10,13,16-hexaoxacyclononadecane |
| SMILES | BrCC1(OCCOCCOC2CCCCO2)COCCOCCOCCOCCOCCOC1 |
| InChI | InChI=1S/C23H43BrO10/c24-19-23(34-18-16-29-15-17-33-22-3-1-2-4-32-22)20-30-13-11-27-9-7-25-5-6-26-8-10-28-12-14-31-21-23/h22H,1-21H2 |
| InChIKey | ZGLQJEKOXZCBMC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|