C27H52O11 — CID 10506912
21-(butoxymethyl)-21-[2-(oxan-2-yloxy)ethoxy]-1,4,7,10,13,16,19-heptaoxacyclodocosane (PubChem CID 10506912) has the molecular formula C27H52O11 and a molecular weight of 552.70 g/mol. Its IUPAC name is 21-(butoxymethyl)-21-[2-(oxan-2-yloxy)ethoxy]-1,4,7,10,13,16,19-heptaoxacyclodocosane.
| Compound Name | 21-(butoxymethyl)-21-[2-(oxan-2-yloxy)ethoxy]-1,4,7,10,13,16,19-heptaoxacyclodocosane |
|---|---|
| PubChem CID | 10506912 |
| Molecular Formula | C27H52O11 |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 21-(butoxymethyl)-21-[2-(oxan-2-yloxy)ethoxy]-1,4,7,10,13,16,19-heptaoxacyclodocosane |
| SMILES | CCCCOCC1(OCCOC2CCCCO2)COCCOCCOCCOCCOCCOCCOC1 |
| InChI | InChI=1S/C27H52O11/c1-2-3-7-33-23-27(38-22-21-37-26-6-4-5-8-36-26)24-34-19-17-31-15-13-29-11-9-28-10-12-30-14-16-32-18-20-35-25-27/h26H,2-25H2,1H3 |
| InChIKey | GJFGCPCZXSWCHA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|