C28H54O12 — CID 102241940
2-[[15-[2-[2-(2-octoxyethoxy)ethoxy]ethoxy]-1,4,7,10,13-pentaoxacyclohexadec-15-yl]methoxy]acetic acid (PubChem CID 102241940) has the molecular formula C28H54O12 and a molecular weight of 582.73 g/mol. Its IUPAC name is 2-[[15-[2-[2-(2-octoxyethoxy)ethoxy]ethoxy]-1,4,7,10,13-pentaoxacyclohexadec-15-yl]methoxy]acetic acid.
| Compound Name | 2-[[15-[2-[2-(2-octoxyethoxy)ethoxy]ethoxy]-1,4,7,10,13-pentaoxacyclohexadec-15-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 102241940 |
| Molecular Formula | C28H54O12 |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | 2-[[15-[2-[2-(2-octoxyethoxy)ethoxy]ethoxy]-1,4,7,10,13-pentaoxacyclohexadec-15-yl]methoxy]acetic acid |
| SMILES | CCCCCCCCOCCOCCOCCOC1(COCC(=O)O)COCCOCCOCCOCCOC1 |
| InChI | InChI=1S/C28H54O12/c1-2-3-4-5-6-7-8-31-9-10-32-15-16-36-21-22-40-28(26-39-23-27(29)30)24-37-19-17-34-13-11-33-12-14-35-18-20-38-25-28/h2-26H2,1H3,(H,29,30) |
| InChIKey | QBEZQCVSBIEAMI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|