C20H39ClO8 — CID 10575221
15-(butoxymethyl)-15-[2-(2-chloroethoxy)ethoxy]-1,4,7,10,13-pentaoxacyclohexadecane (PubChem CID 10575221) has the molecular formula C20H39ClO8 and a molecular weight of 442.98 g/mol. Its IUPAC name is 15-(butoxymethyl)-15-[2-(2-chloroethoxy)ethoxy]-1,4,7,10,13-pentaoxacyclohexadecane.
| Compound Name | 15-(butoxymethyl)-15-[2-(2-chloroethoxy)ethoxy]-1,4,7,10,13-pentaoxacyclohexadecane |
|---|---|
| PubChem CID | 10575221 |
| Molecular Formula | C20H39ClO8 |
| Molecular Weight | 442.98 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 15-(butoxymethyl)-15-[2-(2-chloroethoxy)ethoxy]-1,4,7,10,13-pentaoxacyclohexadecane |
| SMILES | CCCCOCC1(OCCOCCCl)COCCOCCOCCOCCOC1 |
| InChI | InChI=1S/C20H39ClO8/c1-2-3-5-26-17-20(29-16-15-22-6-4-21)18-27-13-11-24-9-7-23-8-10-25-12-14-28-19-20/h2-19H2,1H3 |
| InChIKey | VBOWALSSXHMKAN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.98 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|